C18H35NO5 — CID 156961628
3-(8-hydroxyundecanoyloxy)-4-(trimethylazaniumyl)butanoate (PubChem CID 156961628) has the molecular formula C18H35NO5 and a molecular weight of 345.48 g/mol. Its IUPAC name is 3-(8-hydroxyundecanoyloxy)-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-(8-hydroxyundecanoyloxy)-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156961628 |
| Molecular Formula | C18H35NO5 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 3-(8-hydroxyundecanoyloxy)-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCC(O)CCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C18H35NO5/c1-5-10-15(20)11-8-6-7-9-12-18(23)24-16(13-17(21)22)14-19(2,3)4/h15-16,20H,5-14H2,1-4H3 |
| InChIKey | QDSMAXQSUAKPTJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|