C20H36N2O8 — CID 121454225
3-[6-[1-carboxylato-3-(trimethylazaniumyl)propan-2-yl]oxy-6-oxohexanoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 121454225) has the molecular formula C20H36N2O8 and a molecular weight of 432.51 g/mol. Its IUPAC name is 3-[6-[1-carboxylato-3-(trimethylazaniumyl)propan-2-yl]oxy-6-oxohexanoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[6-[1-carboxylato-3-(trimethylazaniumyl)propan-2-yl]oxy-6-oxohexanoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 121454225 |
| Molecular Formula | C20H36N2O8 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 3-[6-[1-carboxylato-3-(trimethylazaniumyl)propan-2-yl]oxy-6-oxohexanoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C20H36N2O8/c1-21(2,3)13-15(11-17(23)24)29-19(27)9-7-8-10-20(28)30-16(12-18(25)26)14-22(4,5)6/h15-16H,7-14H2,1-6H3 |
| InChIKey | HRBMYZXBMWKCIG-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|