C10H19NO4S — CID 23319428
3-(3-sulfanylpropanoyloxy)-4-(trimethylazaniumyl)butanoate (PubChem CID 23319428) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is 3-(3-sulfanylpropanoyloxy)-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-(3-sulfanylpropanoyloxy)-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 23319428 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-(3-sulfanylpropanoyloxy)-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCS |
| InChI | InChI=1S/C10H19NO4S/c1-11(2,3)7-8(6-9(12)13)15-10(14)4-5-16/h8H,4-7H2,1-3H3,(H-,12,13,16) |
| InChIKey | ZVFOVAGBQFTTIA-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 66.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|