C10H20ClNO4S — CID 173343743
3-(3-sulfanylpropanoyloxy)-4-(trimethylazaniumyl)butanoate;hydrochloride (PubChem CID 173343743) has the molecular formula C10H20ClNO4S and a molecular weight of 285.79 g/mol. Its IUPAC name is 3-(3-sulfanylpropanoyloxy)-4-(trimethylazaniumyl)butanoate;hydrochloride.
| Compound Name | 3-(3-sulfanylpropanoyloxy)-4-(trimethylazaniumyl)butanoate;hydrochloride |
|---|---|
| PubChem CID | 173343743 |
| Molecular Formula | C10H20ClNO4S |
| Molecular Weight | 285.79 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 3-(3-sulfanylpropanoyloxy)-4-(trimethylazaniumyl)butanoate;hydrochloride |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCS.Cl |
| InChI | InChI=1S/C10H19NO4S.ClH/c1-11(2,3)7-8(6-9(12)13)15-10(14)4-5-16;/h8H,4-7H2,1-3H3,(H-,12,13,16);1H |
| InChIKey | OZWLZCVUVYMWKL-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 66.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.79 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|