C12H21NO4 — CID 156962568
3-[(E)-pent-3-enoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156962568) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 3-[(E)-pent-3-enoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(E)-pent-3-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156962568 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 3-[(E)-pent-3-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C/C=C/CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C12H21NO4/c1-5-6-7-12(16)17-10(8-11(14)15)9-13(2,3)4/h5-6,10H,7-9H2,1-4H3/b6-5+ |
| InChIKey | FKCFAOUKERDIER-AATRIKPKSA-N |
| XLogP | -0.29 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|