C14H25NO5 — CID 156962611
3-[(E)-3-hydroxyhept-5-enoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156962611) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-[(E)-3-hydroxyhept-5-enoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(E)-3-hydroxyhept-5-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156962611 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 3-[(E)-3-hydroxyhept-5-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C/C=C/CC(O)CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C14H25NO5/c1-5-6-7-11(16)8-14(19)20-12(9-13(17)18)10-15(2,3)4/h5-6,11-12,16H,7-10H2,1-4H3/b6-5+ |
| InChIKey | ODXVXZSLYPJSLI-AATRIKPKSA-N |
| XLogP | -0.54 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|