C22H40N2O9 — CID 87185335
3-but-2-enoyloxy-4-(trimethylazaniumyl)butanoate;3-(3-hydroxybutanoyloxy)-4-(trimethylazaniumyl)butanoate (PubChem CID 87185335) has the molecular formula C22H40N2O9 and a molecular weight of 476.57 g/mol. Its IUPAC name is 3-but-2-enoyloxy-4-(trimethylazaniumyl)butanoate;3-(3-hydroxybutanoyloxy)-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-but-2-enoyloxy-4-(trimethylazaniumyl)butanoate;3-(3-hydroxybutanoyloxy)-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 87185335 |
| Molecular Formula | C22H40N2O9 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 3-but-2-enoyloxy-4-(trimethylazaniumyl)butanoate;3-(3-hydroxybutanoyloxy)-4-(trimethylazaniumyl)butanoate |
| SMILES | CC(O)CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C.CC=CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C11H21NO5.C11H19NO4/c1-8(13)5-11(16)17-9(6-10(14)15)7-12(2,3)4;1-5-6-11(15)16-9(7-10(13)14)8-12(2,3)4/h8-9,13H,5-7H2,1-4H3;5-6,9H,7-8H2,1-4H3 |
| InChIKey | GMCWCRYXNBGOIV-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|