C12H23NO5 — CID 118194969
3-(3-hydroxypentanoyloxy)-4-(trimethylazaniumyl)butanoate (PubChem CID 118194969) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-(3-hydroxypentanoyloxy)-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-(3-hydroxypentanoyloxy)-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 118194969 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 3-(3-hydroxypentanoyloxy)-4-(trimethylazaniumyl)butanoate |
| SMILES | CCC(O)CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C12H23NO5/c1-5-9(14)6-12(17)18-10(7-11(15)16)8-13(2,3)4/h9-10,14H,5-8H2,1-4H3 |
| InChIKey | SHDVOJJCEZGPBX-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|