C14H23MgNO10 — CID 53340052
magnesium;2,3-dihydroxybutanedioate;(3R)-3-propanoyloxy-4-(trimethylazaniumyl)butanoate (PubChem CID 53340052) has the molecular formula C14H23MgNO10 and a molecular weight of 389.64 g/mol. Its IUPAC name is magnesium;2,3-dihydroxybutanedioate;(3R)-3-propanoyloxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | magnesium;2,3-dihydroxybutanedioate;(3R)-3-propanoyloxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 53340052 |
| Molecular Formula | C14H23MgNO10 |
| Molecular Weight | 389.64 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | magnesium;2,3-dihydroxybutanedioate;(3R)-3-propanoyloxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CCC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C.O=C([O-])C(O)C(O)C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C10H19NO4.C4H6O6.Mg/c1-5-10(14)15-8(6-9(12)13)7-11(2,3)4;5-1(3(7)8)2(6)4(9)10;/h8H,5-7H2,1-4H3;1-2,5-6H,(H,7,8)(H,9,10);/q;;+2/p-2/t8-;;/m1../s1 |
| InChIKey | GAVFZJOBDMCMDP-YCBDHFTFSA-L |
| XLogP | -6.02 |
| TPSA | 187.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.64 |
| LogP ≤ 5 | -6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|