C13H23NO7 — CID 156961424
3-(4-carboxy-3-hydroxypentanoyl)oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156961424) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-(4-carboxy-3-hydroxypentanoyl)oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-(4-carboxy-3-hydroxypentanoyl)oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156961424 |
| Molecular Formula | C13H23NO7 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 3-(4-carboxy-3-hydroxypentanoyl)oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CC(C(=O)O)C(O)CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C13H23NO7/c1-8(13(19)20)10(15)6-12(18)21-9(5-11(16)17)7-14(2,3)4/h8-10,15H,5-7H2,1-4H3,(H-,16,17,19,20) |
| InChIKey | YCBJGNWIYBPVHF-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|