C17H34N2O6 — CID 118437373
(2S)-2-amino-3-methylbutanoic acid;3-(3-methylbutanoyloxy)-4-(trimethylazaniumyl)butanoate (PubChem CID 118437373) has the molecular formula C17H34N2O6 and a molecular weight of 362.47 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;3-(3-methylbutanoyloxy)-4-(trimethylazaniumyl)butanoate.
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;3-(3-methylbutanoyloxy)-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 118437373 |
| Molecular Formula | C17H34N2O6 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;3-(3-methylbutanoyloxy)-4-(trimethylazaniumyl)butanoate |
| SMILES | CC(C)CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C.CC(C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H23NO4.C5H11NO2/c1-9(2)6-12(16)17-10(7-11(14)15)8-13(3,4)5;1-3(2)4(6)5(7)8/h9-10H,6-8H2,1-5H3;3-4H,6H2,1-2H3,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | NPMAAKVCTOPJRF-VWMHFEHESA-N |
| XLogP | -0.16 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|