C11H19NO6 — CID 91825610
(3R)-3-(2-carboxypropanoyloxy)-4-(trimethylazaniumyl)butanoate (PubChem CID 91825610) has the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. Its IUPAC name is (3R)-3-(2-carboxypropanoyloxy)-4-(trimethylazaniumyl)butanoate.
| Compound Name | (3R)-3-(2-carboxypropanoyloxy)-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 91825610 |
| Molecular Formula | C11H19NO6 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (3R)-3-(2-carboxypropanoyloxy)-4-(trimethylazaniumyl)butanoate |
| SMILES | CC(C(=O)O)C(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C11H19NO6/c1-7(10(15)16)11(17)18-8(5-9(13)14)6-12(2,3)4/h7-8H,5-6H2,1-4H3,(H-,13,14,15,16)/t7?,8-/m1/s1 |
| InChIKey | XROYFEWIXXCPAW-BRFYHDHCSA-N |
| XLogP | -1.53 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|