C11H20ClNO6 — CID 71750420
[3-carboxy-2-(2-carboxy-3,3,3-trideuteriopropanoyl)oxypropyl]-trimethylazanium chloride (PubChem CID 71750420) has the molecular formula C11H20ClNO6 and a molecular weight of 300.75 g/mol. Its IUPAC name is [3-carboxy-2-(2-carboxy-3,3,3-trideuteriopropanoyl)oxypropyl]-trimethylazanium chloride.
| Compound Name | [3-carboxy-2-(2-carboxy-3,3,3-trideuteriopropanoyl)oxypropyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 71750420 |
| Molecular Formula | C11H20ClNO6 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [3-carboxy-2-(2-carboxy-3,3,3-trideuteriopropanoyl)oxypropyl]-trimethylazanium chloride |
| SMILES | [2H]C([2H])([2H])C(C(=O)O)C(=O)OC(CC(=O)O)C[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C11H19NO6.ClH/c1-7(10(15)16)11(17)18-8(5-9(13)14)6-12(2,3)4;/h7-8H,5-6H2,1-4H3,(H-,13,14,15,16);1H/i1D3; |
| InChIKey | GCTKNVUCBFQXAL-NIIDSAIPSA-N |
| XLogP | -3.20 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|