C11H20NO6+ — CID 169446575
[(2R)-3-carboxy-2-(3-carboxypropanoyloxy)propyl]-tri((113C)methyl)azanium (PubChem CID 169446575) has the molecular formula C11H20NO6+ and a molecular weight of 265.26 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-(3-carboxypropanoyloxy)propyl]-tri((113C)methyl)azanium.
| Compound Name | [(2R)-3-carboxy-2-(3-carboxypropanoyloxy)propyl]-tri((113C)methyl)azanium |
|---|---|
| PubChem CID | 169446575 |
| Molecular Formula | C11H20NO6+ |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | [(2R)-3-carboxy-2-(3-carboxypropanoyloxy)propyl]-tri((113C)methyl)azanium |
| SMILES | [13CH3][N+]([13CH3])([13CH3])C[C@@H](CC(=O)O)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C11H19NO6/c1-12(2,3)7-8(6-10(15)16)18-11(17)5-4-9(13)14/h8H,4-7H2,1-3H3,(H-,13,14,15,16)/p+1/t8-/m1/s1/i1+1,2+1,3+1 |
| InChIKey | HAEVNYBCYZZDFL-CRDGYOKGSA-O |
| XLogP | -0.06 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|