C14H26NO6+ — CID 156960914
[(2R)-3-carboxy-2-[(3S)-5-carboxy-3-methylpentanoyl]oxypropyl]-trimethylazanium (PubChem CID 156960914) has the molecular formula C14H26NO6+ and a molecular weight of 304.36 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[(3S)-5-carboxy-3-methylpentanoyl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[(3S)-5-carboxy-3-methylpentanoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156960914 |
| Molecular Formula | C14H26NO6+ |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | [(2R)-3-carboxy-2-[(3S)-5-carboxy-3-methylpentanoyl]oxypropyl]-trimethylazanium |
| SMILES | C[C@@H](CCC(=O)O)CC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C14H25NO6/c1-10(5-6-12(16)17)7-14(20)21-11(8-13(18)19)9-15(2,3)4/h10-11H,5-9H2,1-4H3,(H-,16,17,18,19)/p+1/t10-,11+/m0/s1 |
| InChIKey | QUTVQBTYWOJSOG-WDEREUQCSA-O |
| XLogP | 0.97 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|