C12H22NO6+ — CID 53481623
[(2S)-3-carboxy-2-(4-carboxybutanoyloxy)propyl]-trimethylazanium (PubChem CID 53481623) has the molecular formula C12H22NO6+ and a molecular weight of 276.31 g/mol. Its IUPAC name is [(2S)-3-carboxy-2-(4-carboxybutanoyloxy)propyl]-trimethylazanium.
| Compound Name | [(2S)-3-carboxy-2-(4-carboxybutanoyloxy)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 53481623 |
| Molecular Formula | C12H22NO6+ |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | [(2S)-3-carboxy-2-(4-carboxybutanoyloxy)propyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C[C@H](CC(=O)O)OC(=O)CCCC(=O)O |
| InChI | InChI=1S/C12H21NO6/c1-13(2,3)8-9(7-11(16)17)19-12(18)6-4-5-10(14)15/h9H,4-8H2,1-3H3,(H-,14,15,16,17)/p+1/t9-/m0/s1 |
| InChIKey | NXJAXUYOQLTISD-VIFPVBQESA-O |
| XLogP | 0.33 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|