C23H44NO7+ — CID 156962320
[3-carboxy-2-(15-carboxy-6-hydroxypentadecanoyl)oxypropyl]-trimethylazanium (PubChem CID 156962320) has the molecular formula C23H44NO7+ and a molecular weight of 446.61 g/mol. Its IUPAC name is [3-carboxy-2-(15-carboxy-6-hydroxypentadecanoyl)oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-(15-carboxy-6-hydroxypentadecanoyl)oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962320 |
| Molecular Formula | C23H44NO7+ |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | [3-carboxy-2-(15-carboxy-6-hydroxypentadecanoyl)oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OC(=O)CCCCC(O)CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C23H43NO7/c1-24(2,3)18-20(17-22(28)29)31-23(30)16-12-11-14-19(25)13-9-7-5-4-6-8-10-15-21(26)27/h19-20,25H,4-18H2,1-3H3,(H-,26,27,28,29)/p+1 |
| InChIKey | BGKHHGPLAYWAIJ-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|