C17H32NO7+ — CID 156961600
[3-carboxy-2-(9-carboxy-4-hydroxynonanoyl)oxypropyl]-trimethylazanium (PubChem CID 156961600) has the molecular formula C17H32NO7+ and a molecular weight of 362.44 g/mol. Its IUPAC name is [3-carboxy-2-(9-carboxy-4-hydroxynonanoyl)oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-(9-carboxy-4-hydroxynonanoyl)oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156961600 |
| Molecular Formula | C17H32NO7+ |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | [3-carboxy-2-(9-carboxy-4-hydroxynonanoyl)oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OC(=O)CCC(O)CCCCCC(=O)O |
| InChI | InChI=1S/C17H31NO7/c1-18(2,3)12-14(11-16(22)23)25-17(24)10-9-13(19)7-5-4-6-8-15(20)21/h13-14,19H,4-12H2,1-3H3,(H-,20,21,22,23)/p+1 |
| InChIKey | JBGUBFZEOMPZPU-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|