C13H24NO7+ — CID 156962590
[3-carboxy-2-(5-carboxy-3-hydroxypentanoyl)oxypropyl]-trimethylazanium (PubChem CID 156962590) has the molecular formula C13H24NO7+ and a molecular weight of 306.34 g/mol. Its IUPAC name is [3-carboxy-2-(5-carboxy-3-hydroxypentanoyl)oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-(5-carboxy-3-hydroxypentanoyl)oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962590 |
| Molecular Formula | C13H24NO7+ |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [3-carboxy-2-(5-carboxy-3-hydroxypentanoyl)oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OC(=O)CC(O)CCC(=O)O |
| InChI | InChI=1S/C13H23NO7/c1-14(2,3)8-10(7-12(18)19)21-13(20)6-9(15)4-5-11(16)17/h9-10,15H,4-8H2,1-3H3,(H-,16,17,18,19)/p+1 |
| InChIKey | WXQCPIKDHISECD-UHFFFAOYSA-O |
| XLogP | -0.31 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|