C19H36NO5+ — CID 156961765
[3-carboxy-2-[(E)-3-hydroxydodec-8-enoyl]oxypropyl]-trimethylazanium (PubChem CID 156961765) has the molecular formula C19H36NO5+ and a molecular weight of 358.50 g/mol. Its IUPAC name is [3-carboxy-2-[(E)-3-hydroxydodec-8-enoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(E)-3-hydroxydodec-8-enoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156961765 |
| Molecular Formula | C19H36NO5+ |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | [3-carboxy-2-[(E)-3-hydroxydodec-8-enoyl]oxypropyl]-trimethylazanium |
| SMILES | CCC/C=C/CCCCC(O)CC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C19H35NO5/c1-5-6-7-8-9-10-11-12-16(21)13-19(24)25-17(14-18(22)23)15-20(2,3)4/h7-8,16-17,21H,5-6,9-15H2,1-4H3/p+1/b8-7+ |
| InChIKey | JZBXJZFITRBBLL-BQYQJAHWSA-O |
| XLogP | 2.75 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|