C25H48ClNO5 — CID 169441862
[(2R)-3-carboxy-2-[(Z)-18,18,18-trideuterio-3-hydroxyoctadec-9-enoyl]oxypropyl]-trimethylazanium chloride (PubChem CID 169441862) has the molecular formula C25H48ClNO5 and a molecular weight of 481.13 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[(Z)-18,18,18-trideuterio-3-hydroxyoctadec-9-enoyl]oxypropyl]-trimethylazanium chloride.
| Compound Name | [(2R)-3-carboxy-2-[(Z)-18,18,18-trideuterio-3-hydroxyoctadec-9-enoyl]oxypropyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 169441862 |
| Molecular Formula | C25H48ClNO5 |
| Molecular Weight | 481.13 g/mol |
| Exact Mass | 480.34 |
| IUPAC Name | [(2R)-3-carboxy-2-[(Z)-18,18,18-trideuterio-3-hydroxyoctadec-9-enoyl]oxypropyl]-trimethylazanium chloride |
| SMILES | [2H]C([2H])([2H])CCCCCCC/C=C\CCCCCC(O)CC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C25H47NO5.ClH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(27)19-25(30)31-23(20-24(28)29)21-26(2,3)4;/h12-13,22-23,27H,5-11,14-21H2,1-4H3;1H/b13-12-;/t22?,23-;/m1./s1/i1D3; |
| InChIKey | HIDAXZYLGSUREE-GHELJQQTSA-N |
| XLogP | 2.09 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.13 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|