C29H50NO5+ — CID 156962496
[3-carboxy-2-[(7E,10E,13E,16E)-3-hydroxydocosa-7,10,13,16-tetraenoyl]oxypropyl]-trimethylazanium (PubChem CID 156962496) has the molecular formula C29H50NO5+ and a molecular weight of 492.72 g/mol. Its IUPAC name is [3-carboxy-2-[(7E,10E,13E,16E)-3-hydroxydocosa-7,10,13,16-tetraenoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(7E,10E,13E,16E)-3-hydroxydocosa-7,10,13,16-tetraenoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962496 |
| Molecular Formula | C29H50NO5+ |
| Molecular Weight | 492.72 g/mol |
| Exact Mass | 492.37 |
| IUPAC Name | [3-carboxy-2-[(7E,10E,13E,16E)-3-hydroxydocosa-7,10,13,16-tetraenoyl]oxypropyl]-trimethylazanium |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCC(O)CC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C29H49NO5/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26(31)23-29(34)35-27(24-28(32)33)25-30(2,3)4/h9-10,12-13,15-16,18-19,26-27,31H,5-8,11,14,17,20-25H2,1-4H3/p+1/b10-9+,13-12+,16-15+,19-18+ |
| InChIKey | VNDDHCLZKGIEPZ-WFYBHXQRSA-O |
| XLogP | 5.98 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.72 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|