C25H46NO4+ — CID 169443035
[(2R)-3-carboxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl]-dimethyl-(trideuteriomethyl)azanium (PubChem CID 169443035) has the molecular formula C25H46NO4+ and a molecular weight of 427.66 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl]-dimethyl-(trideuteriomethyl)azanium.
| Compound Name | [(2R)-3-carboxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl]-dimethyl-(trideuteriomethyl)azanium |
|---|---|
| PubChem CID | 169443035 |
| Molecular Formula | C25H46NO4+ |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.36 |
| IUPAC Name | [(2R)-3-carboxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl]-dimethyl-(trideuteriomethyl)azanium |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C25H45NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(29)30-23(21-24(27)28)22-26(2,3)4/h9-10,12-13,23H,5-8,11,14-22H2,1-4H3/p+1/b10-9-,13-12-/t23-/m1/s1/i2D3 |
| InChIKey | MJLXQSQYKZWZCB-HFPRWIQZSA-O |
| XLogP | 5.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|