C21H40ClNO4 — CID 169446894
[(2R)-3-carboxy-2-[(Z)-tetradec-5-enoyl]oxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride (PubChem CID 169446894) has the molecular formula C21H40ClNO4 and a molecular weight of 409.03 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[(Z)-tetradec-5-enoyl]oxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride.
| Compound Name | [(2R)-3-carboxy-2-[(Z)-tetradec-5-enoyl]oxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride |
|---|---|
| PubChem CID | 169446894 |
| Molecular Formula | C21H40ClNO4 |
| Molecular Weight | 409.03 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | [(2R)-3-carboxy-2-[(Z)-tetradec-5-enoyl]oxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CCC/C=C\CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C21H39NO4.ClH/c1-5-6-7-8-9-10-11-12-13-14-15-16-21(25)26-19(17-20(23)24)18-22(2,3)4;/h12-13,19H,5-11,14-18H2,1-4H3;1H/b13-12-;/t19-;/m1./s1/i2D3; |
| InChIKey | FAGBGIPJTBCGLN-CHAPWEDJSA-N |
| XLogP | 1.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.03 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|