C17H32NO4+ — CID 89350727
[3-carboxy-2-[(E)-dec-4-enoyl]oxypropyl]-trimethylazanium (PubChem CID 89350727) has the molecular formula C17H32NO4+ and a molecular weight of 314.45 g/mol. Its IUPAC name is [3-carboxy-2-[(E)-dec-4-enoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(E)-dec-4-enoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 89350727 |
| Molecular Formula | C17H32NO4+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | [3-carboxy-2-[(E)-dec-4-enoyl]oxypropyl]-trimethylazanium |
| SMILES | CCCCC/C=C/CCC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C17H31NO4/c1-5-6-7-8-9-10-11-12-17(21)22-15(13-16(19)20)14-18(2,3)4/h9-10,15H,5-8,11-14H2,1-4H3/p+1/b10-9+ |
| InChIKey | OQWOHRPOYAVIOK-MDZDMXLPSA-O |
| XLogP | 3.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|