C19H35NO5 — CID 156961762
3-[(E)-3-hydroxydodec-6-enoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156961762) has the molecular formula C19H35NO5 and a molecular weight of 357.49 g/mol. Its IUPAC name is 3-[(E)-3-hydroxydodec-6-enoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(E)-3-hydroxydodec-6-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156961762 |
| Molecular Formula | C19H35NO5 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 3-[(E)-3-hydroxydodec-6-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCC/C=C/CCC(O)CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C19H35NO5/c1-5-6-7-8-9-10-11-12-16(21)13-19(24)25-17(14-18(22)23)15-20(2,3)4/h9-10,16-17,21H,5-8,11-15H2,1-4H3/b10-9+ |
| InChIKey | NFLPRKGOEUZRJH-MDZDMXLPSA-N |
| XLogP | 1.41 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|