C25H47NO5 — CID 78076337
3-(3-hydroxyoctadec-9-enoyloxy)-4-(trimethylazaniumyl)butanoate (PubChem CID 78076337) has the molecular formula C25H47NO5 and a molecular weight of 441.65 g/mol. Its IUPAC name is 3-(3-hydroxyoctadec-9-enoyloxy)-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-(3-hydroxyoctadec-9-enoyloxy)-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 78076337 |
| Molecular Formula | C25H47NO5 |
| Molecular Weight | 441.65 g/mol |
| Exact Mass | 441.35 |
| IUPAC Name | 3-(3-hydroxyoctadec-9-enoyloxy)-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCCCC=CCCCCCC(O)CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C25H47NO5/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(27)19-25(30)31-23(20-24(28)29)21-26(2,3)4/h12-13,22-23,27H,5-11,14-21H2,1-4H3 |
| InChIKey | YBCVTTMMURGSEY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|