C25H46NO5+ — CID 71464557
[3-carboxy-2-[(9Z,12Z)-3-hydroxyoctadeca-9,12-dienoyl]oxypropyl]-trimethylazanium (PubChem CID 71464557) has the molecular formula C25H46NO5+ and a molecular weight of 440.65 g/mol. Its IUPAC name is [3-carboxy-2-[(9Z,12Z)-3-hydroxyoctadeca-9,12-dienoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(9Z,12Z)-3-hydroxyoctadeca-9,12-dienoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 71464557 |
| Molecular Formula | C25H46NO5+ |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | [3-carboxy-2-[(9Z,12Z)-3-hydroxyoctadeca-9,12-dienoyl]oxypropyl]-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCC(O)CC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C25H45NO5/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(27)19-25(30)31-23(20-24(28)29)21-26(2,3)4/h9-10,12-13,22-23,27H,5-8,11,14-21H2,1-4H3/p+1/b10-9-,13-12- |
| InChIKey | WQYXCASYXUFNSI-UTJQPWESSA-O |
| XLogP | 4.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|