C20H36NO5+ — CID 156961979
[3-carboxy-2-[(5E,7E)-3-hydroxytrideca-5,7-dienoyl]oxypropyl]-trimethylazanium (PubChem CID 156961979) has the molecular formula C20H36NO5+ and a molecular weight of 370.51 g/mol. Its IUPAC name is [3-carboxy-2-[(5E,7E)-3-hydroxytrideca-5,7-dienoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(5E,7E)-3-hydroxytrideca-5,7-dienoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156961979 |
| Molecular Formula | C20H36NO5+ |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | [3-carboxy-2-[(5E,7E)-3-hydroxytrideca-5,7-dienoyl]oxypropyl]-trimethylazanium |
| SMILES | CCCCC/C=C/C=C/CC(O)CC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C20H35NO5/c1-5-6-7-8-9-10-11-12-13-17(22)14-20(25)26-18(15-19(23)24)16-21(2,3)4/h9-12,17-18,22H,5-8,13-16H2,1-4H3/p+1/b10-9+,12-11+ |
| InChIKey | IVIYURUSLMLSTM-HULFFUFUSA-O |
| XLogP | 2.91 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|