C16H30N2O8+2 — CID 174457270
[(2R)-3-carboxy-2-[2-[(2R)-1-carboxy-3-(trimethylazaniumyl)propan-2-yl]oxy-2-oxoacetyl]oxypropyl]-trimethylazanium (PubChem CID 174457270) has the molecular formula C16H30N2O8+2 and a molecular weight of 378.42 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[2-[(2R)-1-carboxy-3-(trimethylazaniumyl)propan-2-yl]oxy-2-oxoacetyl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[2-[(2R)-1-carboxy-3-(trimethylazaniumyl)propan-2-yl]oxy-2-oxoacetyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 174457270 |
| Molecular Formula | C16H30N2O8+2 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(2R)-3-carboxy-2-[2-[(2R)-1-carboxy-3-(trimethylazaniumyl)propan-2-yl]oxy-2-oxoacetyl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)C(=O)O[C@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C16H28N2O8/c1-17(2,3)9-11(7-13(19)20)25-15(23)16(24)26-12(8-14(21)22)10-18(4,5)6/h11-12H,7-10H2,1-6H3/p+2/t11-,12-/m1/s1 |
| InChIKey | XNUBVQZRGOHTPR-VXGBXAGGSA-P |
| XLogP | -0.83 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|