C11H22NO4S+ — CID 167418351
[(2R)-3-carboxy-2-propan-2-ylsulfanylcarbonyloxypropyl]-trimethylazanium (PubChem CID 167418351) has the molecular formula C11H22NO4S+ and a molecular weight of 264.37 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-propan-2-ylsulfanylcarbonyloxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-propan-2-ylsulfanylcarbonyloxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 167418351 |
| Molecular Formula | C11H22NO4S+ |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | [(2R)-3-carboxy-2-propan-2-ylsulfanylcarbonyloxypropyl]-trimethylazanium |
| SMILES | CC(C)SC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C11H21NO4S/c1-8(2)17-11(15)16-9(6-10(13)14)7-12(3,4)5/h8-9H,6-7H2,1-5H3/p+1/t9-/m1/s1 |
| InChIKey | KSYHBJPTGBYYAU-SECBINFHSA-O |
| XLogP | 1.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|