C9H18BrNO4 — CID 85078131
(2-acetyloxy-3-carboxypropyl)-trimethylazanium bromide (PubChem CID 85078131) has the molecular formula C9H18BrNO4 and a molecular weight of 284.15 g/mol. Its IUPAC name is (2-acetyloxy-3-carboxypropyl)-trimethylazanium bromide.
| Compound Name | (2-acetyloxy-3-carboxypropyl)-trimethylazanium bromide |
|---|---|
| PubChem CID | 85078131 |
| Molecular Formula | C9H18BrNO4 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | (2-acetyloxy-3-carboxypropyl)-trimethylazanium bromide |
| SMILES | CC(=O)OC(CC(=O)O)C[N+](C)(C)C.[Br-] |
| InChI | InChI=1S/C9H17NO4.BrH/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;/h8H,5-6H2,1-4H3;1H |
| InChIKey | OVOPZVYLBYWUFI-UHFFFAOYSA-N |
| XLogP | -2.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|