C11H24N2O7S — CID 11602334
[(2R)-2-acetyloxy-3-carboxypropyl]-trimethylazanium;2-aminoethanesulfonate (PubChem CID 11602334) has the molecular formula C11H24N2O7S and a molecular weight of 328.39 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-carboxypropyl]-trimethylazanium;2-aminoethanesulfonate.
| Compound Name | [(2R)-2-acetyloxy-3-carboxypropyl]-trimethylazanium;2-aminoethanesulfonate |
|---|---|
| PubChem CID | 11602334 |
| Molecular Formula | C11H24N2O7S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(2R)-2-acetyloxy-3-carboxypropyl]-trimethylazanium;2-aminoethanesulfonate |
| SMILES | CC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.NCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H17NO4.C2H7NO3S/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;3-1-2-7(4,5)6/h8H,5-6H2,1-4H3;1-3H2,(H,4,5,6)/t8-;/m1./s1 |
| InChIKey | BQGBBTYEIVIBIO-DDWIOCJRSA-N |
| XLogP | -1.41 |
| TPSA | 146.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|