C16H33ClN2O7 — CID 87307948
(3R)-3-acetyloxy-4-(trimethylazaniumyl)butanoate;3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride (PubChem CID 87307948) has the molecular formula C16H33ClN2O7 and a molecular weight of 400.90 g/mol. Its IUPAC name is (3R)-3-acetyloxy-4-(trimethylazaniumyl)butanoate;3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride.
| Compound Name | (3R)-3-acetyloxy-4-(trimethylazaniumyl)butanoate;3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride |
|---|---|
| PubChem CID | 87307948 |
| Molecular Formula | C16H33ClN2O7 |
| Molecular Weight | 400.90 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (3R)-3-acetyloxy-4-(trimethylazaniumyl)butanoate;3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride |
| SMILES | CC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C.C[N+](C)(C)CC(O)CC(=O)[O-].Cl |
| InChI | InChI=1S/C9H17NO4.C7H15NO3.ClH/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;1-8(2,3)5-6(9)4-7(10)11;/h8H,5-6H2,1-4H3;6,9H,4-5H2,1-3H3;1H/t8-;;/m1../s1 |
| InChIKey | AAVOMOCHZDNJLM-YCBDHFTFSA-N |
| XLogP | -2.62 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.90 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|