C9H18N2O7 — CID 175019232
3-acetyloxy-4-(trimethylazaniumyl)butanoate;nitric acid (PubChem CID 175019232) has the molecular formula C9H18N2O7 and a molecular weight of 266.25 g/mol. Its IUPAC name is 3-acetyloxy-4-(trimethylazaniumyl)butanoate;nitric acid.
| Compound Name | 3-acetyloxy-4-(trimethylazaniumyl)butanoate;nitric acid |
|---|---|
| PubChem CID | 175019232 |
| Molecular Formula | C9H18N2O7 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-acetyloxy-4-(trimethylazaniumyl)butanoate;nitric acid |
| SMILES | CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C.O=[N+]([O-])O |
| InChI | InChI=1S/C9H17NO4.HNO3/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;2-1(3)4/h8H,5-6H2,1-4H3;(H,2,3,4) |
| InChIKey | DWTOZDIGOPAGDI-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|