C9H17NO5 — CID 23358561
3-(2-hydroxyacetyl)oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 23358561) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-(2-hydroxyacetyl)oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-(2-hydroxyacetyl)oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 23358561 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 3-(2-hydroxyacetyl)oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CO |
| InChI | InChI=1S/C9H17NO5/c1-10(2,3)5-7(4-8(12)13)15-9(14)6-11/h7,11H,4-6H2,1-3H3 |
| InChIKey | CGALRBHTEZSWGM-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|