C11H24ClNO5 — CID 175496067
3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride (PubChem CID 175496067) has the molecular formula C11H24ClNO5 and a molecular weight of 285.77 g/mol. Its IUPAC name is 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride.
| Compound Name | 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride |
|---|---|
| PubChem CID | 175496067 |
| Molecular Formula | C11H24ClNO5 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride |
| SMILES | CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C.CCO.Cl |
| InChI | InChI=1S/C9H17NO4.C2H6O.ClH/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;1-2-3;/h8H,5-6H2,1-4H3;3H,2H2,1H3;1H |
| InChIKey | XSLXKORRUFYVDX-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|