About 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride
3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride (PubChem CID 175496067) has the molecular formula C11H24ClNO5
and a molecular weight of 285.77 g/mol. Its IUPAC name is 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride.
Molecular Properties
| Compound Name | 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride |
| PubChem CID | 175496067 |
| Molecular Formula | C11H24ClNO5 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride |
| SMILES | CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C.CCO.Cl |
| InChI | InChI=1S/C9H17NO4.C2H6O.ClH/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;1-2-3;/h8H,5-6H2,1-4H3;3H,2H2,1H3;1H |
| InChIKey | XSLXKORRUFYVDX-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride?
The IUPAC name of 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride (CID 175496067) is 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride.
What is the SMILES notation for 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride?
The canonical SMILES for 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride is CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C.CCO.Cl.
What is the InChIKey of 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride?
The InChIKey is XSLXKORRUFYVDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4.C2H6O.ClH/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;1-2-3;/h8H,5-6H2,1-4H3;3H,2H2,1H3;1H.
What are the key properties of 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride?
3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride has a molecular weight of 285.77 g/mol, XLogP of -0.82, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyloxy-4-(trimethylazaniumyl)butanoate;ethanol;hydrochloride is sourced from PubChem (CID 175496067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).