C10H20N2O4 — CID 174248725
3-(ethylcarbamoyloxy)-4-(trimethylazaniumyl)butanoate (PubChem CID 174248725) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-(ethylcarbamoyloxy)-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-(ethylcarbamoyloxy)-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 174248725 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 3-(ethylcarbamoyloxy)-4-(trimethylazaniumyl)butanoate |
| SMILES | CCNC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C10H20N2O4/c1-5-11-10(15)16-8(6-9(13)14)7-12(2,3)4/h8H,5-7H2,1-4H3,(H-,11,13,14,15) |
| InChIKey | RJHAUTRAVYCMDI-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|