C14H28ClNO9 — CID 87749319
(3R)-3-acetyloxy-4-(trimethylazaniumyl)butanoate;(2R,3R,4R)-2,3,4,5-tetrahydroxypentanal;hydrochloride (PubChem CID 87749319) has the molecular formula C14H28ClNO9 and a molecular weight of 389.83 g/mol. Its IUPAC name is (3R)-3-acetyloxy-4-(trimethylazaniumyl)butanoate;(2R,3R,4R)-2,3,4,5-tetrahydroxypentanal;hydrochloride.
| Compound Name | (3R)-3-acetyloxy-4-(trimethylazaniumyl)butanoate;(2R,3R,4R)-2,3,4,5-tetrahydroxypentanal;hydrochloride |
|---|---|
| PubChem CID | 87749319 |
| Molecular Formula | C14H28ClNO9 |
| Molecular Weight | 389.83 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (3R)-3-acetyloxy-4-(trimethylazaniumyl)butanoate;(2R,3R,4R)-2,3,4,5-tetrahydroxypentanal;hydrochloride |
| SMILES | CC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C.Cl.O=C[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H17NO4.C5H10O5.ClH/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;6-1-3(8)5(10)4(9)2-7;/h8H,5-6H2,1-4H3;1,3-5,7-10H,2H2;1H/t8-;3-,4+,5-;/m10./s1 |
| InChIKey | INZYDVAKQOOEDB-HSZBZORBSA-N |
| XLogP | -3.55 |
| TPSA | 164.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.83 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|