C12H25ClN2O6 — CID 87549986
acetyl (2S)-2-aminopropanoate;(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride (PubChem CID 87549986) has the molecular formula C12H25ClN2O6 and a molecular weight of 328.79 g/mol. Its IUPAC name is acetyl (2S)-2-aminopropanoate;(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride.
| Compound Name | acetyl (2S)-2-aminopropanoate;(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride |
|---|---|
| PubChem CID | 87549986 |
| Molecular Formula | C12H25ClN2O6 |
| Molecular Weight | 328.79 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | acetyl (2S)-2-aminopropanoate;(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride |
| SMILES | CC(=O)OC(=O)[C@H](C)N.C[N+](C)(C)C[C@H](O)CC(=O)[O-].Cl |
| InChI | InChI=1S/C7H15NO3.C5H9NO3.ClH/c1-8(2,3)5-6(9)4-7(10)11;1-3(6)5(8)9-4(2)7;/h6,9H,4-5H2,1-3H3;3H,6H2,1-2H3;1H/t6-;3-;/m10./s1 |
| InChIKey | XJPYALPYOAJEDX-KSNMZBQQSA-N |
| XLogP | -1.96 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.79 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|