C12H25N3O6 — CID 87324443
(2S)-2,5-diamino-5-oxopentanoic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate (PubChem CID 87324443) has the molecular formula C12H25N3O6 and a molecular weight of 307.35 g/mol. Its IUPAC name is (2S)-2,5-diamino-5-oxopentanoic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | (2S)-2,5-diamino-5-oxopentanoic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 87324443 |
| Molecular Formula | C12H25N3O6 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (2S)-2,5-diamino-5-oxopentanoic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(O)CC(=O)[O-].NC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H15NO3.C5H10N2O3/c1-8(2,3)5-6(9)4-7(10)11;6-3(5(9)10)1-2-4(7)8/h6,9H,4-5H2,1-3H3;3H,1-2,6H2,(H2,7,8)(H,9,10)/t;3-/m.0/s1 |
| InChIKey | HNNKABURFPGHBQ-HVDRVSQOSA-N |
| XLogP | -3.14 |
| TPSA | 166.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|