C10H23KN2O9P — CID 157413009
CID 157413009 (PubChem CID 157413009) has the molecular formula C10H23KN2O9P and a molecular weight of 385.37 g/mol.
| Compound Name | CID 157413009 |
|---|---|
| PubChem CID | 157413009 |
| Molecular Formula | C10H23KN2O9P |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | — |
| SMILES | C[N+](C)(C)C[C@H](O)CC(=O)[O-].N[C@@H](COP(=O)(O)O)C(=O)O.[K] |
| InChI | InChI=1S/C7H15NO3.C3H8NO6P.K/c1-8(2,3)5-6(9)4-7(10)11;4-2(3(5)6)1-10-11(7,8)9;/h6,9H,4-5H2,1-3H3;2H,1,4H2,(H,5,6)(H2,7,8,9);/t6-;2-;/m10./s1 |
| InChIKey | BOMXVEOYHQMLAY-XCFYDNNVSA-N |
| XLogP | -3.68 |
| TPSA | 190.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|