C13H26N2O7 — CID 155352070
2-acetamido-3-hydroxybutanoic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate (PubChem CID 155352070) has the molecular formula C13H26N2O7 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-acetamido-3-hydroxybutanoic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 2-acetamido-3-hydroxybutanoic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 155352070 |
| Molecular Formula | C13H26N2O7 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-acetamido-3-hydroxybutanoic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CC(=O)NC(C(=O)O)C(C)O.C[N+](C)(C)CC(O)CC(=O)[O-] |
| InChI | InChI=1S/C7H15NO3.C6H11NO4/c1-8(2,3)5-6(9)4-7(10)11;1-3(8)5(6(10)11)7-4(2)9/h6,9H,4-5H2,1-3H3;3,5,8H,1-2H3,(H,7,9)(H,10,11) |
| InChIKey | SFGGBENWNJYJOF-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 146.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|