C8H16N2O6 — CID 138543857
2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid (PubChem CID 138543857) has the molecular formula C8H16N2O6 and a molecular weight of 236.22 g/mol. Its IUPAC name is 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid.
| Compound Name | 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid |
|---|---|
| PubChem CID | 138543857 |
| Molecular Formula | C8H16N2O6 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid |
| SMILES | CC(=O)NC(C(=O)O)C(C)O.NCC(=O)O |
| InChI | InChI=1S/C6H11NO4.C2H5NO2/c1-3(8)5(6(10)11)7-4(2)9;3-1-2(4)5/h3,5,8H,1-2H3,(H,7,9)(H,10,11);1,3H2,(H,4,5) |
| InChIKey | RGHXZUZIWOXNLB-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |