2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid

C8H16N2O6 — CID 138543857

IUPAC2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid
SMILESCC(=O)NC(C(=O)O)C(C)O.NCC(=O)O
InChIInChI=1S/C6H11NO4.C2H5NO2/c1-3(8)5(6(10)11)7-4(2)9;3-1-2(4)5/h3,5,8H,1-2H3,(H,7,9)(H,10,11);1,3H2,(H,4,5)
InChIKeyRGHXZUZIWOXNLB-UHFFFAOYSA-N
MW236.22 g/mol
LogP-2.01
Rot. Bonds4

About 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid

2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid (PubChem CID 138543857) has the molecular formula C8H16N2O6 and a molecular weight of 236.22 g/mol. Its IUPAC name is 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid.

Molecular Properties

Compound Name2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid
PubChem CID138543857
Molecular FormulaC8H16N2O6
Molecular Weight236.22 g/mol
Exact Mass236.10
IUPAC Name2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid
SMILESCC(=O)NC(C(=O)O)C(C)O.NCC(=O)O
InChIInChI=1S/C6H11NO4.C2H5NO2/c1-3(8)5(6(10)11)7-4(2)9;3-1-2(4)5/h3,5,8H,1-2H3,(H,7,9)(H,10,11);1,3H2,(H,4,5)
InChIKeyRGHXZUZIWOXNLB-UHFFFAOYSA-N
XLogP-2.01
TPSA149.95 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.22
LogP ≤ 5-2.01
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid?
The IUPAC name of 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid (CID 138543857) is 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid.
What is the SMILES notation for 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid?
The canonical SMILES for 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid is CC(=O)NC(C(=O)O)C(C)O.NCC(=O)O.
What is the InChIKey of 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid?
The InChIKey is RGHXZUZIWOXNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4.C2H5NO2/c1-3(8)5(6(10)11)7-4(2)9;3-1-2(4)5/h3,5,8H,1-2H3,(H,7,9)(H,10,11);1,3H2,(H,4,5).
What are the key properties of 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid?
2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid has a molecular weight of 236.22 g/mol, XLogP of -2.01, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-hydroxybutanoic acid;2-aminoacetic acid is sourced from PubChem (CID 138543857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).