C7H14N2O3 — CID 155415665
2-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]acetamide (PubChem CID 155415665) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]acetamide.
| Compound Name | 2-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]acetamide |
|---|---|
| PubChem CID | 155415665 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]acetamide |
| SMILES | CC(=O)[C@@H](NC(=O)CN)[C@@H](C)O |
| InChI | InChI=1S/C7H14N2O3/c1-4(10)7(5(2)11)9-6(12)3-8/h4,7,10H,3,8H2,1-2H3,(H,9,12)/t4-,7+/m1/s1 |
| InChIKey | GJVBLFAPVVHZGJ-FBCQKBJTSA-N |
| XLogP | -1.60 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |