About 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide
6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide (PubChem CID 163435862) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide.
Molecular Properties
| Compound Name | 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide |
| PubChem CID | 163435862 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide |
| SMILES | CC(=O)[C@@H](NC(=O)CCCCCN)[C@@H](C)O |
| InChI | InChI=1S/C11H22N2O3/c1-8(14)11(9(2)15)13-10(16)6-4-3-5-7-12/h8,11,14H,3-7,12H2,1-2H3,(H,13,16)/t8-,11+/m1/s1 |
| InChIKey | AULCOZBTEXUZNS-KCJUWKMLSA-N |
| XLogP | -0.04 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide?
The IUPAC name of 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide (CID 163435862) is 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide.
What is the SMILES notation for 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide?
The canonical SMILES for 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide is CC(=O)[C@@H](NC(=O)CCCCCN)[C@@H](C)O.
What is the InChIKey of 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide?
The InChIKey is AULCOZBTEXUZNS-KCJUWKMLSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-8(14)11(9(2)15)13-10(16)6-4-3-5-7-12/h8,11,14H,3-7,12H2,1-2H3,(H,13,16)/t8-,11+/m1/s1.
What are the key properties of 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide?
6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide has a molecular weight of 230.31 g/mol, XLogP of -0.04, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-[(2R,3S)-2-hydroxy-4-oxopentan-3-yl]hexanamide is sourced from PubChem (CID 163435862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).