C7H16N2O2 — CID 89042363
2-amino-N-[(3S)-2-hydroxypentan-3-yl]acetamide (PubChem CID 89042363) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-amino-N-[(3S)-2-hydroxypentan-3-yl]acetamide.
| Compound Name | 2-amino-N-[(3S)-2-hydroxypentan-3-yl]acetamide |
|---|---|
| PubChem CID | 89042363 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 2-amino-N-[(3S)-2-hydroxypentan-3-yl]acetamide |
| SMILES | CC[C@H](NC(=O)CN)C(C)O |
| InChI | InChI=1S/C7H16N2O2/c1-3-6(5(2)10)9-7(11)4-8/h5-6,10H,3-4,8H2,1-2H3,(H,9,11)/t5?,6-/m0/s1 |
| InChIKey | IWYBZVLGRSANEW-GDVGLLTNSA-N |
| XLogP | -0.78 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |