C8H18N2OS — CID 115734463
2-amino-N-(4-ethylsulfanylbutan-2-yl)acetamide (PubChem CID 115734463) has the molecular formula C8H18N2OS and a molecular weight of 190.31 g/mol. Its IUPAC name is 2-amino-N-(4-ethylsulfanylbutan-2-yl)acetamide.
| Compound Name | 2-amino-N-(4-ethylsulfanylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 115734463 |
| Molecular Formula | C8H18N2OS |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-amino-N-(4-ethylsulfanylbutan-2-yl)acetamide |
| SMILES | CCSCCC(C)NC(=O)CN |
| InChI | InChI=1S/C8H18N2OS/c1-3-12-5-4-7(2)10-8(11)6-9/h7H,3-6,9H2,1-2H3,(H,10,11) |
| InChIKey | UWOIACDTHRFEAO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|