C7H16N2OS — CID 117126539
N-(1-aminopropan-2-yl)-2-ethylsulfanylacetamide (PubChem CID 117126539) has the molecular formula C7H16N2OS and a molecular weight of 176.28 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-2-ethylsulfanylacetamide.
| Compound Name | N-(1-aminopropan-2-yl)-2-ethylsulfanylacetamide |
|---|---|
| PubChem CID | 117126539 |
| Molecular Formula | C7H16N2OS |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | N-(1-aminopropan-2-yl)-2-ethylsulfanylacetamide |
| SMILES | CCSCC(=O)NC(C)CN |
| InChI | InChI=1S/C7H16N2OS/c1-3-11-5-7(10)9-6(2)4-8/h6H,3-5,8H2,1-2H3,(H,9,10) |
| InChIKey | JUGDEAODPNYGMH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |