C10H19NO3S2 — CID 104588503
2-[2-(4-ethylsulfanylbutan-2-ylamino)-2-oxoethyl]sulfanylacetic acid (PubChem CID 104588503) has the molecular formula C10H19NO3S2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-[2-(4-ethylsulfanylbutan-2-ylamino)-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-(4-ethylsulfanylbutan-2-ylamino)-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104588503 |
| Molecular Formula | C10H19NO3S2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-[2-(4-ethylsulfanylbutan-2-ylamino)-2-oxoethyl]sulfanylacetic acid |
| SMILES | CCSCCC(C)NC(=O)CSCC(=O)O |
| InChI | InChI=1S/C10H19NO3S2/c1-3-15-5-4-8(2)11-9(12)6-16-7-10(13)14/h8H,3-7H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | PVCXMWQRDHHVOP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|